C20H14ClN3O4 — CID 169330002
4-amino-5-[3-[(2-chlorophenoxy)methyl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169330002) has the molecular formula C20H14ClN3O4 and a molecular weight of 395.80 g/mol. Its IUPAC name is 4-amino-5-[3-[(2-chlorophenoxy)methyl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[3-[(2-chlorophenoxy)methyl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169330002 |
| Molecular Formula | C20H14ClN3O4 |
| Molecular Weight | 395.80 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 4-amino-5-[3-[(2-chlorophenoxy)methyl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1cccc(COc3ccccc3Cl)c1)C(=O)NC2=O |
| InChI | InChI=1S/C20H14ClN3O4/c21-14-6-1-2-7-15(14)28-10-11-4-3-5-12(8-11)24-16(25)9-13-17(18(24)22)20(27)23-19(13)26/h1-9H,10,22H2,(H,23,26,27) |
| InChIKey | BNKNQNKHECFMKK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.80 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|