C17H16N4O3 — CID 169331189
4-amino-5-(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169331189) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 4-amino-5-(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169331189 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 4-amino-5-(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | CC1CCc2cc(-n3c(N)c4c(cc3=O)C(=O)NC4=O)ccc2N1 |
| InChI | InChI=1S/C17H16N4O3/c1-8-2-3-9-6-10(4-5-12(9)19-8)21-13(22)7-11-14(15(21)18)17(24)20-16(11)23/h4-8,19H,2-3,18H2,1H3,(H,20,23,24) |
| InChIKey | XTXUXDUBLRCZQA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|