C20H22N4O5S — CID 169328608
4-amino-5-[3-(3-methylpiperidin-1-yl)-4-methylsulfonylphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169328608) has the molecular formula C20H22N4O5S and a molecular weight of 430.49 g/mol. Its IUPAC name is 4-amino-5-[3-(3-methylpiperidin-1-yl)-4-methylsulfonylphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[3-(3-methylpiperidin-1-yl)-4-methylsulfonylphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169328608 |
| Molecular Formula | C20H22N4O5S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 4-amino-5-[3-(3-methylpiperidin-1-yl)-4-methylsulfonylphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | CC1CCCN(c2cc(-n3c(N)c4c(cc3=O)C(=O)NC4=O)ccc2S(C)(=O)=O)C1 |
| InChI | InChI=1S/C20H22N4O5S/c1-11-4-3-7-23(10-11)14-8-12(5-6-15(14)30(2,28)29)24-16(25)9-13-17(18(24)21)20(27)22-19(13)26/h5-6,8-9,11H,3-4,7,10,21H2,1-2H3,(H,22,26,27) |
| InChIKey | PXHUNQIGWWXNHT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|