C16H15N3O5S — CID 169330091
4-amino-5-(2,6-dimethyl-3-methylsulfonylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169330091) has the molecular formula C16H15N3O5S and a molecular weight of 361.38 g/mol. Its IUPAC name is 4-amino-5-(2,6-dimethyl-3-methylsulfonylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(2,6-dimethyl-3-methylsulfonylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169330091 |
| Molecular Formula | C16H15N3O5S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 4-amino-5-(2,6-dimethyl-3-methylsulfonylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Cc1ccc(S(C)(=O)=O)c(C)c1-n1c(N)c2c(cc1=O)C(=O)NC2=O |
| InChI | InChI=1S/C16H15N3O5S/c1-7-4-5-10(25(3,23)24)8(2)13(7)19-11(20)6-9-12(14(19)17)16(22)18-15(9)21/h4-6H,17H2,1-3H3,(H,18,21,22) |
| InChIKey | NCYHVOGYWJRKFI-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 128.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|