C18H14N4O3 — CID 169327950
3-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3,5-dimethylphenyl]prop-2-enenitrile (PubChem CID 169327950) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 3-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3,5-dimethylphenyl]prop-2-enenitrile.
| Compound Name | 3-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3,5-dimethylphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 169327950 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 3-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3,5-dimethylphenyl]prop-2-enenitrile |
| SMILES | Cc1cc(C=CC#N)cc(C)c1-n1c(N)c2c(cc1=O)C(=O)NC2=O |
| InChI | InChI=1S/C18H14N4O3/c1-9-6-11(4-3-5-19)7-10(2)15(9)22-13(23)8-12-14(16(22)20)18(25)21-17(12)24/h3-4,6-8H,20H2,1-2H3,(H,21,24,25) |
| InChIKey | MWYSBEZLQAWROZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|