C13H8BrN3O2 — CID 169333546
5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde (PubChem CID 169333546) has the molecular formula C13H8BrN3O2 and a molecular weight of 318.13 g/mol. Its IUPAC name is 5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169333546 |
| Molecular Formula | C13H8BrN3O2 |
| Molecular Weight | 318.13 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | 5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccc(-n3cnc(Br)n3)cc2)o1 |
| InChI | InChI=1S/C13H8BrN3O2/c14-13-15-8-17(16-13)10-3-1-9(2-4-10)12-6-5-11(7-18)19-12/h1-8H |
| InChIKey | IVNLRASEZBEMQP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.13 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|