About 5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde
5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde (PubChem CID 169333546) has the molecular formula C13H8BrN3O2
and a molecular weight of 318.13 g/mol. Its IUPAC name is 5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde |
| PubChem CID | 169333546 |
| Molecular Formula | C13H8BrN3O2 |
| Molecular Weight | 318.13 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | 5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccc(-n3cnc(Br)n3)cc2)o1 |
| InChI | InChI=1S/C13H8BrN3O2/c14-13-15-8-17(16-13)10-3-1-9(2-4-10)12-6-5-11(7-18)19-12/h1-8H |
| InChIKey | IVNLRASEZBEMQP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.13 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde?
The IUPAC name of 5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde (CID 169333546) is 5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde.
What is the SMILES notation for 5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde?
The canonical SMILES for 5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde is O=Cc1ccc(-c2ccc(-n3cnc(Br)n3)cc2)o1.
What is the InChIKey of 5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde?
The InChIKey is IVNLRASEZBEMQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrN3O2/c14-13-15-8-17(16-13)10-3-1-9(2-4-10)12-6-5-11(7-18)19-12/h1-8H.
What are the key properties of 5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde?
5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde has a molecular weight of 318.13 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(3-bromo-1,2,4-triazol-1-yl)phenyl]furan-2-carbaldehyde is sourced from PubChem (CID 169333546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).