C20H13BrO5 — CID 169334872
5-[6-(4-bromobenzoyl)-2,3-dihydro-1,4-benzodioxin-7-yl]furan-2-carbaldehyde (PubChem CID 169334872) has the molecular formula C20H13BrO5 and a molecular weight of 413.22 g/mol. Its IUPAC name is 5-[6-(4-bromobenzoyl)-2,3-dihydro-1,4-benzodioxin-7-yl]furan-2-carbaldehyde.
| Compound Name | 5-[6-(4-bromobenzoyl)-2,3-dihydro-1,4-benzodioxin-7-yl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169334872 |
| Molecular Formula | C20H13BrO5 |
| Molecular Weight | 413.22 g/mol |
| Exact Mass | 411.99 |
| IUPAC Name | 5-[6-(4-bromobenzoyl)-2,3-dihydro-1,4-benzodioxin-7-yl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cc3c(cc2C(=O)c2ccc(Br)cc2)OCCO3)o1 |
| InChI | InChI=1S/C20H13BrO5/c21-13-3-1-12(2-4-13)20(23)16-10-19-18(24-7-8-25-19)9-15(16)17-6-5-14(11-22)26-17/h1-6,9-11H,7-8H2 |
| InChIKey | NCIHVOKRCMOVPQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.22 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|