C21H27NO5S — CID 169334975
2-(5-formylfuran-2-yl)-N-(2-hydroxypropyl)-N-(4-methylcyclohexyl)benzenesulfonamide (PubChem CID 169334975) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-(5-formylfuran-2-yl)-N-(2-hydroxypropyl)-N-(4-methylcyclohexyl)benzenesulfonamide.
| Compound Name | 2-(5-formylfuran-2-yl)-N-(2-hydroxypropyl)-N-(4-methylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 169334975 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-(5-formylfuran-2-yl)-N-(2-hydroxypropyl)-N-(4-methylcyclohexyl)benzenesulfonamide |
| SMILES | CC(O)CN(C1CCC(C)CC1)S(=O)(=O)c1ccccc1-c1ccc(C=O)o1 |
| InChI | InChI=1S/C21H27NO5S/c1-15-7-9-17(10-8-15)22(13-16(2)24)28(25,26)21-6-4-3-5-19(21)20-12-11-18(14-23)27-20/h3-6,11-12,14-17,24H,7-10,13H2,1-2H3 |
| InChIKey | KXZCJZOFQGDNSI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|