C16H24N4O3S — CID 169326125
2-azido-N-(2-hydroxypropyl)-N-(4-methylcyclohexyl)benzenesulfonamide (PubChem CID 169326125) has the molecular formula C16H24N4O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-azido-N-(2-hydroxypropyl)-N-(4-methylcyclohexyl)benzenesulfonamide.
| Compound Name | 2-azido-N-(2-hydroxypropyl)-N-(4-methylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 169326125 |
| Molecular Formula | C16H24N4O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-azido-N-(2-hydroxypropyl)-N-(4-methylcyclohexyl)benzenesulfonamide |
| SMILES | CC(O)CN(C1CCC(C)CC1)S(=O)(=O)c1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C16H24N4O3S/c1-12-7-9-14(10-8-12)20(11-13(2)21)24(22,23)16-6-4-3-5-15(16)18-19-17/h3-6,12-14,21H,7-11H2,1-2H3 |
| InChIKey | SHTUSFYHXHFPDV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 106.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|