C15H17ClN6 — CID 169338217
2-[[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169338217) has the molecular formula C15H17ClN6 and a molecular weight of 316.80 g/mol. Its IUPAC name is 2-[[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169338217 |
| Molecular Formula | C15H17ClN6 |
| Molecular Weight | 316.80 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-[[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]hydrazinylidene]propanedinitrile |
| SMILES | CCN1CCN(c2c(Cl)cccc2NN=C(C#N)C#N)CC1 |
| InChI | InChI=1S/C15H17ClN6/c1-2-21-6-8-22(9-7-21)15-13(16)4-3-5-14(15)20-19-12(10-17)11-18/h3-5,20H,2,6-9H2,1H3 |
| InChIKey | IFGSSORXJRKVBZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.80 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|