C9H6BrN5O2S — CID 169340090
2-bromo-6-[2-(dicyanomethylidene)hydrazinyl]benzenesulfonamide (PubChem CID 169340090) has the molecular formula C9H6BrN5O2S and a molecular weight of 328.15 g/mol. Its IUPAC name is 2-bromo-6-[2-(dicyanomethylidene)hydrazinyl]benzenesulfonamide.
| Compound Name | 2-bromo-6-[2-(dicyanomethylidene)hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 169340090 |
| Molecular Formula | C9H6BrN5O2S |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 326.94 |
| IUPAC Name | 2-bromo-6-[2-(dicyanomethylidene)hydrazinyl]benzenesulfonamide |
| SMILES | N#CC(C#N)=NNc1cccc(Br)c1S(N)(=O)=O |
| InChI | InChI=1S/C9H6BrN5O2S/c10-7-2-1-3-8(9(7)18(13,16)17)15-14-6(4-11)5-12/h1-3,15H,(H2,13,16,17) |
| InChIKey | QJIGFWOFFHYABA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|