C13H13N5O — CID 169337914
3-[2-(dicyanomethylidene)hydrazinyl]-N,N,2-trimethylbenzamide (PubChem CID 169337914) has the molecular formula C13H13N5O and a molecular weight of 255.28 g/mol. Its IUPAC name is 3-[2-(dicyanomethylidene)hydrazinyl]-N,N,2-trimethylbenzamide.
| Compound Name | 3-[2-(dicyanomethylidene)hydrazinyl]-N,N,2-trimethylbenzamide |
|---|---|
| PubChem CID | 169337914 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 3-[2-(dicyanomethylidene)hydrazinyl]-N,N,2-trimethylbenzamide |
| SMILES | Cc1c(NN=C(C#N)C#N)cccc1C(=O)N(C)C |
| InChI | InChI=1S/C13H13N5O/c1-9-11(13(19)18(2)3)5-4-6-12(9)17-16-10(7-14)8-15/h4-6,17H,1-3H3 |
| InChIKey | KWBZBAMVPRPZTO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|