C13H9N5O4 — CID 169340232
2-[[6-(2-oxo-1,3-oxazolidin-3-yl)-1,3-benzodioxol-5-yl]hydrazinylidene]propanedinitrile (PubChem CID 169340232) has the molecular formula C13H9N5O4 and a molecular weight of 299.25 g/mol. Its IUPAC name is 2-[[6-(2-oxo-1,3-oxazolidin-3-yl)-1,3-benzodioxol-5-yl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[6-(2-oxo-1,3-oxazolidin-3-yl)-1,3-benzodioxol-5-yl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169340232 |
| Molecular Formula | C13H9N5O4 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-[[6-(2-oxo-1,3-oxazolidin-3-yl)-1,3-benzodioxol-5-yl]hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1cc2c(cc1N1CCOC1=O)OCO2 |
| InChI | InChI=1S/C13H9N5O4/c14-5-8(6-15)16-17-9-3-11-12(22-7-21-11)4-10(9)18-1-2-20-13(18)19/h3-4,17H,1-2,7H2 |
| InChIKey | OZPLMPGFBJDRNE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|