C13H12N6O — CID 169341140
2-[(4,4-dimethyl-2-oxo-1,3-dihydroquinazolin-6-yl)hydrazinylidene]propanedinitrile (PubChem CID 169341140) has the molecular formula C13H12N6O and a molecular weight of 268.28 g/mol. Its IUPAC name is 2-[(4,4-dimethyl-2-oxo-1,3-dihydroquinazolin-6-yl)hydrazinylidene]propanedinitrile.
| Compound Name | 2-[(4,4-dimethyl-2-oxo-1,3-dihydroquinazolin-6-yl)hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169341140 |
| Molecular Formula | C13H12N6O |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-[(4,4-dimethyl-2-oxo-1,3-dihydroquinazolin-6-yl)hydrazinylidene]propanedinitrile |
| SMILES | CC1(C)NC(=O)Nc2ccc(NN=C(C#N)C#N)cc21 |
| InChI | InChI=1S/C13H12N6O/c1-13(2)10-5-8(18-19-9(6-14)7-15)3-4-11(10)16-12(20)17-13/h3-5,18H,1-2H3,(H2,16,17,20) |
| InChIKey | YKHSTGJTMIPXJR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|