C20H23N3O7S3 — CID 16934398
ethyl 2-[[1-(4-methylsulfanylphenyl)sulfonylpiperidine-4-carbonyl]amino]-5-nitrothiophene-3-carboxylate (PubChem CID 16934398) has the molecular formula C20H23N3O7S3 and a molecular weight of 513.62 g/mol. Its IUPAC name is ethyl 2-[[1-(4-methylsulfanylphenyl)sulfonylpiperidine-4-carbonyl]amino]-5-nitrothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[1-(4-methylsulfanylphenyl)sulfonylpiperidine-4-carbonyl]amino]-5-nitrothiophene-3-carboxylate |
|---|---|
| PubChem CID | 16934398 |
| Molecular Formula | C20H23N3O7S3 |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | ethyl 2-[[1-(4-methylsulfanylphenyl)sulfonylpiperidine-4-carbonyl]amino]-5-nitrothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])sc1NC(=O)C1CCN(S(=O)(=O)c2ccc(SC)cc2)CC1 |
| InChI | InChI=1S/C20H23N3O7S3/c1-3-30-20(25)16-12-17(23(26)27)32-19(16)21-18(24)13-8-10-22(11-9-13)33(28,29)15-6-4-14(31-2)5-7-15/h4-7,12-13H,3,8-11H2,1-2H3,(H,21,24) |
| InChIKey | PHRVGRAMJVTRTP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|