About [3-bromo-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]thiourea
[3-bromo-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]thiourea (PubChem CID 169359753) has the molecular formula C14H8BrF5N2OS
and a molecular weight of 427.19 g/mol. Its IUPAC name is [3-bromo-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]thiourea.
Molecular Properties
| Compound Name | [3-bromo-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]thiourea |
| PubChem CID | 169359753 |
| Molecular Formula | C14H8BrF5N2OS |
| Molecular Weight | 427.19 g/mol |
| Exact Mass | 425.95 |
| IUPAC Name | [3-bromo-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]thiourea |
| SMILES | NC(=S)Nc1cccc(Br)c1Oc1c(F)cc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C14H8BrF5N2OS/c15-7-2-1-3-10(22-13(21)24)11(7)23-12-8(16)4-6(5-9(12)17)14(18,19)20/h1-5H,(H3,21,22,24) |
| InChIKey | CYUOVMAYSZUIPJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.19 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [3-bromo-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-bromo-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]thiourea?
The IUPAC name of [3-bromo-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]thiourea (CID 169359753) is [3-bromo-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]thiourea.
What is the SMILES notation for [3-bromo-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]thiourea?
The canonical SMILES for [3-bromo-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]thiourea is NC(=S)Nc1cccc(Br)c1Oc1c(F)cc(C(F)(F)F)cc1F.
What is the InChIKey of [3-bromo-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]thiourea?
The InChIKey is CYUOVMAYSZUIPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BrF5N2OS/c15-7-2-1-3-10(22-13(21)24)11(7)23-12-8(16)4-6(5-9(12)17)14(18,19)20/h1-5H,(H3,21,22,24).
What are the key properties of [3-bromo-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]thiourea?
[3-bromo-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]thiourea has a molecular weight of 427.19 g/mol, XLogP of 5.19, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-bromo-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]thiourea is sourced from PubChem (CID 169359753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).