C12H14N4OS — CID 169360992
methyl N'-(5-acetamido-2-methylphenyl)-N-cyanocarbamimidothioate (PubChem CID 169360992) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is methyl N'-(5-acetamido-2-methylphenyl)-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-(5-acetamido-2-methylphenyl)-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169360992 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | methyl N'-(5-acetamido-2-methylphenyl)-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1cc(NC(C)=O)ccc1C)NC#N |
| InChI | InChI=1S/C12H14N4OS/c1-8-4-5-10(15-9(2)17)6-11(8)16-12(18-3)14-7-13/h4-6H,1-3H3,(H,14,16)(H,15,17) |
| InChIKey | PXPDJXQYYXVHKO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|