C22H18N6S — CID 169362696
methyl N-cyano-N'-[3-(2-methyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-yl)phenyl]carbamimidothioate (PubChem CID 169362696) has the molecular formula C22H18N6S and a molecular weight of 398.50 g/mol. Its IUPAC name is methyl N-cyano-N'-[3-(2-methyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-yl)phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[3-(2-methyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-yl)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169362696 |
| Molecular Formula | C22H18N6S |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | methyl N-cyano-N'-[3-(2-methyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-yl)phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1cccc(-c2ccnc3c(-c4ccccc4)c(C)nn23)c1)NC#N |
| InChI | InChI=1S/C22H18N6S/c1-15-20(16-7-4-3-5-8-16)21-24-12-11-19(28(21)27-15)17-9-6-10-18(13-17)26-22(29-2)25-14-23/h3-13H,1-2H3,(H,25,26) |
| InChIKey | XUQZHWORQCMWON-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|