C10H8ClFN4O — CID 169366627
2-chloro-N'-[3-fluoro-2-(1,2,4-oxadiazol-3-yl)phenyl]ethanimidamide (PubChem CID 169366627) has the molecular formula C10H8ClFN4O and a molecular weight of 254.65 g/mol. Its IUPAC name is 2-chloro-N'-[3-fluoro-2-(1,2,4-oxadiazol-3-yl)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[3-fluoro-2-(1,2,4-oxadiazol-3-yl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169366627 |
| Molecular Formula | C10H8ClFN4O |
| Molecular Weight | 254.65 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-chloro-N'-[3-fluoro-2-(1,2,4-oxadiazol-3-yl)phenyl]ethanimidamide |
| SMILES | N/C(CCl)=N/c1cccc(F)c1-c1ncon1 |
| InChI | InChI=1S/C10H8ClFN4O/c11-4-8(13)15-7-3-1-2-6(12)9(7)10-14-5-17-16-10/h1-3,5H,4H2,(H2,13,15) |
| InChIKey | SJINVYVWRLBXBD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 77.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.65 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|