C11H12FN3O3 — CID 168597024
3-[3-fluoro-2-(1,2,4-oxadiazol-3-yl)anilino]propane-1,2-diol (PubChem CID 168597024) has the molecular formula C11H12FN3O3 and a molecular weight of 253.23 g/mol. Its IUPAC name is 3-[3-fluoro-2-(1,2,4-oxadiazol-3-yl)anilino]propane-1,2-diol.
| Compound Name | 3-[3-fluoro-2-(1,2,4-oxadiazol-3-yl)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168597024 |
| Molecular Formula | C11H12FN3O3 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3-[3-fluoro-2-(1,2,4-oxadiazol-3-yl)anilino]propane-1,2-diol |
| SMILES | OCC(O)CNc1cccc(F)c1-c1ncon1 |
| InChI | InChI=1S/C11H12FN3O3/c12-8-2-1-3-9(13-4-7(17)5-16)10(8)11-14-6-18-15-11/h1-3,6-7,13,16-17H,4-5H2 |
| InChIKey | ZCKZCUSWMYFAMU-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |