C18H26ClFN4O2 — CID 169367499
tert-butyl N-[1-[2-[(1-amino-2-chloroethylidene)amino]-6-fluorophenyl]piperidin-4-yl]carbamate (PubChem CID 169367499) has the molecular formula C18H26ClFN4O2 and a molecular weight of 384.88 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[(1-amino-2-chloroethylidene)amino]-6-fluorophenyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[(1-amino-2-chloroethylidene)amino]-6-fluorophenyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 169367499 |
| Molecular Formula | C18H26ClFN4O2 |
| Molecular Weight | 384.88 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | tert-butyl N-[1-[2-[(1-amino-2-chloroethylidene)amino]-6-fluorophenyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2c(F)cccc2/N=C(/N)CCl)CC1 |
| InChI | InChI=1S/C18H26ClFN4O2/c1-18(2,3)26-17(25)22-12-7-9-24(10-8-12)16-13(20)5-4-6-14(16)23-15(21)11-19/h4-6,12H,7-11H2,1-3H3,(H2,21,23)(H,22,25) |
| InChIKey | HJJZIVWLDCQMQJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.88 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|