C22H30FN3O6 — CID 168568019
dimethyl (E)-2-[2-fluoro-6-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]anilino]but-2-enedioate (PubChem CID 168568019) has the molecular formula C22H30FN3O6 and a molecular weight of 451.50 g/mol. Its IUPAC name is dimethyl (E)-2-[2-fluoro-6-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-fluoro-6-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168568019 |
| Molecular Formula | C22H30FN3O6 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | dimethyl (E)-2-[2-fluoro-6-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1c(F)cccc1N1CCC(NC(=O)OC(C)(C)C)CC1)C(=O)OC |
| InChI | InChI=1S/C22H30FN3O6/c1-22(2,3)32-21(29)24-14-9-11-26(12-10-14)17-8-6-7-15(23)19(17)25-16(20(28)31-5)13-18(27)30-4/h6-8,13-14,25H,9-12H2,1-5H3,(H,24,29)/b16-13+ |
| InChIKey | PFUGAOKRPVJMOV-DTQAZKPQSA-N |
| XLogP | 2.96 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|