C13H18ClFN2O — CID 169367518
2-chloro-N'-[2-(2,2-dimethylpropoxy)-5-fluorophenyl]ethanimidamide (PubChem CID 169367518) has the molecular formula C13H18ClFN2O and a molecular weight of 272.75 g/mol. Its IUPAC name is 2-chloro-N'-[2-(2,2-dimethylpropoxy)-5-fluorophenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[2-(2,2-dimethylpropoxy)-5-fluorophenyl]ethanimidamide |
|---|---|
| PubChem CID | 169367518 |
| Molecular Formula | C13H18ClFN2O |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-chloro-N'-[2-(2,2-dimethylpropoxy)-5-fluorophenyl]ethanimidamide |
| SMILES | CC(C)(C)COc1ccc(F)cc1/N=C(/N)CCl |
| InChI | InChI=1S/C13H18ClFN2O/c1-13(2,3)8-18-11-5-4-9(15)6-10(11)17-12(16)7-14/h4-6H,7-8H2,1-3H3,(H2,16,17) |
| InChIKey | GSGAJISVUNGXCL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|