C25H26F3N3O2S — CID 169373046
N-[4-(4-benzylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]-4-methylbenzenesulfonamide (PubChem CID 169373046) has the molecular formula C25H26F3N3O2S and a molecular weight of 489.56 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169373046 |
| Molecular Formula | C25H26F3N3O2S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H26F3N3O2S/c1-19-7-10-22(11-8-19)34(32,33)29-24-12-9-21(17-23(24)25(26,27)28)31-15-13-30(14-16-31)18-20-5-3-2-4-6-20/h2-12,17,29H,13-16,18H2,1H3 |
| InChIKey | REOBGPHCJRFADU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |