C21H21F3N4O — CID 168523823
N-[4-(4-benzylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]-2-cyanoacetamide (PubChem CID 168523823) has the molecular formula C21H21F3N4O and a molecular weight of 402.42 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]-2-cyanoacetamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]-2-cyanoacetamide |
|---|---|
| PubChem CID | 168523823 |
| Molecular Formula | C21H21F3N4O |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]-2-cyanoacetamide |
| SMILES | N#CCC(=O)Nc1ccc(N2CCN(Cc3ccccc3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H21F3N4O/c22-21(23,24)18-14-17(6-7-19(18)26-20(29)8-9-25)28-12-10-27(11-13-28)15-16-4-2-1-3-5-16/h1-7,14H,8,10-13,15H2,(H,26,29) |
| InChIKey | GVLYKKQNFUALRI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |