C13H14N2O5S2 — CID 169373397
4-hydroxy-3-[(4-methylphenyl)sulfonylamino]benzenesulfonamide (PubChem CID 169373397) has the molecular formula C13H14N2O5S2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-hydroxy-3-[(4-methylphenyl)sulfonylamino]benzenesulfonamide.
| Compound Name | 4-hydroxy-3-[(4-methylphenyl)sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 169373397 |
| Molecular Formula | C13H14N2O5S2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 4-hydroxy-3-[(4-methylphenyl)sulfonylamino]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(S(N)(=O)=O)ccc2O)cc1 |
| InChI | InChI=1S/C13H14N2O5S2/c1-9-2-4-10(5-3-9)22(19,20)15-12-8-11(21(14,17)18)6-7-13(12)16/h2-8,15-16H,1H3,(H2,14,17,18) |
| InChIKey | LCDLDQHSAFQLNW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|