C20H15F4NO3S — CID 169373451
N-[4-(4-fluorophenoxy)-2-(trifluoromethyl)phenyl]-4-methylbenzenesulfonamide (PubChem CID 169373451) has the molecular formula C20H15F4NO3S and a molecular weight of 425.40 g/mol. Its IUPAC name is N-[4-(4-fluorophenoxy)-2-(trifluoromethyl)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-(4-fluorophenoxy)-2-(trifluoromethyl)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169373451 |
| Molecular Formula | C20H15F4NO3S |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | N-[4-(4-fluorophenoxy)-2-(trifluoromethyl)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(Oc3ccc(F)cc3)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H15F4NO3S/c1-13-2-9-17(10-3-13)29(26,27)25-19-11-8-16(12-18(19)20(22,23)24)28-15-6-4-14(21)5-7-15/h2-12,25H,1H3 |
| InChIKey | WZOVSTUYHHESOR-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |