C20H26F3N7O — CID 169375520
1-[4-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]piperazin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 169375520) has the molecular formula C20H26F3N7O and a molecular weight of 437.47 g/mol. Its IUPAC name is 1-[4-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]piperazin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[4-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]piperazin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 169375520 |
| Molecular Formula | C20H26F3N7O |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 1-[4-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]piperazin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | NC1=NC2(CCCCC2)N(c2ccc(N3CCN(C(=O)C(F)(F)F)CC3)cc2)C(N)=N1 |
| InChI | InChI=1S/C20H26F3N7O/c21-20(22,23)16(31)29-12-10-28(11-13-29)14-4-6-15(7-5-14)30-18(25)26-17(24)27-19(30)8-2-1-3-9-19/h4-7H,1-3,8-13H2,(H4,24,25,26,27) |
| InChIKey | ZWXYJQQTBMLJIP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|