C22H23N7OS — CID 169376331
N-(1,3-benzothiazol-2-yl)-4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzamide (PubChem CID 169376331) has the molecular formula C22H23N7OS and a molecular weight of 433.54 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzamide |
|---|---|
| PubChem CID | 169376331 |
| Molecular Formula | C22H23N7OS |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzamide |
| SMILES | NC1=NC2(CCCCC2)N(c2ccc(C(=O)Nc3nc4ccccc4s3)cc2)C(N)=N1 |
| InChI | InChI=1S/C22H23N7OS/c23-19-27-20(24)29(22(28-19)12-4-1-5-13-22)15-10-8-14(9-11-15)18(30)26-21-25-16-6-2-3-7-17(16)31-21/h2-3,6-11H,1,4-5,12-13H2,(H,25,26,30)(H4,23,24,27,28) |
| InChIKey | PRRLXJBOCYZIFW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |