C18H27N5S — CID 169377370
5-(4-butylsulfanylphenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169377370) has the molecular formula C18H27N5S and a molecular weight of 345.52 g/mol. Its IUPAC name is 5-(4-butylsulfanylphenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-(4-butylsulfanylphenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169377370 |
| Molecular Formula | C18H27N5S |
| Molecular Weight | 345.52 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 5-(4-butylsulfanylphenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | CCCCSc1ccc(N2C(N)=NC(N)=NC23CCCCC3)cc1 |
| InChI | InChI=1S/C18H27N5S/c1-2-3-13-24-15-9-7-14(8-10-15)23-17(20)21-16(19)22-18(23)11-5-4-6-12-18/h7-10H,2-6,11-13H2,1H3,(H4,19,20,21,22) |
| InChIKey | GJRNUSPZTXCMSH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|