C18H22N6O2 — CID 169377597
[3-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-1,2-oxazol-5-yl]methanol (PubChem CID 169377597) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is [3-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-1,2-oxazol-5-yl]methanol.
| Compound Name | [3-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-1,2-oxazol-5-yl]methanol |
|---|---|
| PubChem CID | 169377597 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | [3-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-1,2-oxazol-5-yl]methanol |
| SMILES | NC1=NC2(CCCCC2)N(c2ccc(-c3cc(CO)on3)cc2)C(N)=N1 |
| InChI | InChI=1S/C18H22N6O2/c19-16-21-17(20)24(18(22-16)8-2-1-3-9-18)13-6-4-12(5-7-13)15-10-14(11-25)26-23-15/h4-7,10,25H,1-3,8-9,11H2,(H4,19,20,21,22) |
| InChIKey | PIDNRPFGHPMGLD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 126.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |