C23H27N9 — CID 169379195
[5,7-diamino-6-cyano-4-[4-[[cyclohexyl(methyl)amino]methyl]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169379195) has the molecular formula C23H27N9 and a molecular weight of 429.53 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-[4-[[cyclohexyl(methyl)amino]methyl]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-[4-[[cyclohexyl(methyl)amino]methyl]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169379195 |
| Molecular Formula | C23H27N9 |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | [5,7-diamino-6-cyano-4-[4-[[cyclohexyl(methyl)amino]methyl]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | CN(Cc1ccc(C2N=C(NC#N)Nc3nc(N)c(C#N)c(N)c32)cc1)C1CCCCC1 |
| InChI | InChI=1S/C23H27N9/c1-32(16-5-3-2-4-6-16)12-14-7-9-15(10-8-14)20-18-19(26)17(11-24)21(27)30-22(18)31-23(29-20)28-13-25/h7-10,16,20H,2-6,12H2,1H3,(H6,26,27,28,29,30,31) |
| InChIKey | IAMVBGMLTGXITO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 152.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|