C18H18FN9 — CID 169380818
[5,7-diamino-6-cyano-4-[3-[(dimethylamino)methyl]-5-fluorophenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169380818) has the molecular formula C18H18FN9 and a molecular weight of 379.40 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-[3-[(dimethylamino)methyl]-5-fluorophenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-[3-[(dimethylamino)methyl]-5-fluorophenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169380818 |
| Molecular Formula | C18H18FN9 |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | [5,7-diamino-6-cyano-4-[3-[(dimethylamino)methyl]-5-fluorophenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | CN(C)Cc1cc(F)cc(C2N=C(NC#N)Nc3nc(N)c(C#N)c(N)c32)c1 |
| InChI | InChI=1S/C18H18FN9/c1-28(2)7-9-3-10(5-11(19)4-9)15-13-14(22)12(6-20)16(23)26-17(13)27-18(25-15)24-8-21/h3-5,15H,7H2,1-2H3,(H6,22,23,24,25,26,27) |
| InChIKey | PXXWHDJEFBXYDE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 152.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|