C23H25N9O2 — CID 169381178
ethyl 1-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]piperidine-4-carboxylate (PubChem CID 169381178) has the molecular formula C23H25N9O2 and a molecular weight of 459.51 g/mol. Its IUPAC name is ethyl 1-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 169381178 |
| Molecular Formula | C23H25N9O2 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | ethyl 1-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc(C3N=C(NC#N)Nc4nc(N)c(C#N)c(N)c43)cc2)CC1 |
| InChI | InChI=1S/C23H25N9O2/c1-2-34-22(33)14-7-9-32(10-8-14)15-5-3-13(4-6-15)19-17-18(26)16(11-24)20(27)30-21(17)31-23(29-19)28-12-25/h3-6,14,19H,2,7-10H2,1H3,(H6,26,27,28,29,30,31) |
| InChIKey | AGJZGJVIEJHTRJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 178.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|