C22H31N3O — CID 169385485
1-[[4-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]phenyl]methyl]-2-phenylhydrazine (PubChem CID 169385485) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is 1-[[4-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]phenyl]methyl]-2-phenylhydrazine.
| Compound Name | 1-[[4-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]phenyl]methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169385485 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 1-[[4-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]phenyl]methyl]-2-phenylhydrazine |
| SMILES | CC1CC(C)CN(CCOc2ccc(CNNc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C22H31N3O/c1-18-14-19(2)17-25(16-18)12-13-26-22-10-8-20(9-11-22)15-23-24-21-6-4-3-5-7-21/h3-11,18-19,23-24H,12-17H2,1-2H3 |
| InChIKey | JHCCWNMPJJIEKV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|