C21H29N3O2 — CID 169385842
1-[[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]phenyl]methyl]-2-phenylhydrazine (PubChem CID 169385842) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-[[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]phenyl]methyl]-2-phenylhydrazine.
| Compound Name | 1-[[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]phenyl]methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169385842 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 1-[[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]phenyl]methyl]-2-phenylhydrazine |
| SMILES | CC1CN(CCOc2ccccc2CNNc2ccccc2)CC(C)O1 |
| InChI | InChI=1S/C21H29N3O2/c1-17-15-24(16-18(2)26-17)12-13-25-21-11-7-6-8-19(21)14-22-23-20-9-4-3-5-10-20/h3-11,17-18,22-23H,12-16H2,1-2H3 |
| InChIKey | MDJMLMALBQKQDL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|