C20H23N3S — CID 169386846
1-[[4-(4-tert-butyl-1,3-thiazol-2-yl)phenyl]methyl]-2-phenylhydrazine (PubChem CID 169386846) has the molecular formula C20H23N3S and a molecular weight of 337.49 g/mol. Its IUPAC name is 1-[[4-(4-tert-butyl-1,3-thiazol-2-yl)phenyl]methyl]-2-phenylhydrazine.
| Compound Name | 1-[[4-(4-tert-butyl-1,3-thiazol-2-yl)phenyl]methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169386846 |
| Molecular Formula | C20H23N3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 1-[[4-(4-tert-butyl-1,3-thiazol-2-yl)phenyl]methyl]-2-phenylhydrazine |
| SMILES | CC(C)(C)c1csc(-c2ccc(CNNc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C20H23N3S/c1-20(2,3)18-14-24-19(22-18)16-11-9-15(10-12-16)13-21-23-17-7-5-4-6-8-17/h4-12,14,21,23H,13H2,1-3H3 |
| InChIKey | QRGJICCBFLYBMQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|