C29H26N2O7 — CID 169389075
dimethyl 3-[3-ethoxy-4-(4-methylbenzoyl)oxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169389075) has the molecular formula C29H26N2O7 and a molecular weight of 514.53 g/mol. Its IUPAC name is dimethyl 3-[3-ethoxy-4-(4-methylbenzoyl)oxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[3-ethoxy-4-(4-methylbenzoyl)oxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169389075 |
| Molecular Formula | C29H26N2O7 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | dimethyl 3-[3-ethoxy-4-(4-methylbenzoyl)oxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | CCOc1cc(-c2nn(-c3ccccc3)c(C(=O)OC)c2C(=O)OC)ccc1OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H26N2O7/c1-5-37-23-17-20(15-16-22(23)38-27(32)19-13-11-18(2)12-14-19)25-24(28(33)35-3)26(29(34)36-4)31(30-25)21-9-7-6-8-10-21/h6-17H,5H2,1-4H3 |
| InChIKey | KPCLXWKEMLCMBI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 105.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|