C26H28N2O8 — CID 169389442
dimethyl 3-[3-ethoxy-4-(1-ethoxy-1-oxopropan-2-yl)oxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169389442) has the molecular formula C26H28N2O8 and a molecular weight of 496.52 g/mol. Its IUPAC name is dimethyl 3-[3-ethoxy-4-(1-ethoxy-1-oxopropan-2-yl)oxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[3-ethoxy-4-(1-ethoxy-1-oxopropan-2-yl)oxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169389442 |
| Molecular Formula | C26H28N2O8 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | dimethyl 3-[3-ethoxy-4-(1-ethoxy-1-oxopropan-2-yl)oxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)C(C)Oc1ccc(-c2nn(-c3ccccc3)c(C(=O)OC)c2C(=O)OC)cc1OCC |
| InChI | InChI=1S/C26H28N2O8/c1-6-34-20-15-17(13-14-19(20)36-16(3)24(29)35-7-2)22-21(25(30)32-4)23(26(31)33-5)28(27-22)18-11-9-8-10-12-18/h8-16H,6-7H2,1-5H3 |
| InChIKey | RHYGPQJQMAYKDK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 115.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|