C20H20N4O4 — CID 169390521
ethyl 6-amino-5-cyano-4-(5-methoxy-2-pyrazol-1-ylphenyl)-2-methyl-4H-pyran-3-carboxylate (PubChem CID 169390521) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is ethyl 6-amino-5-cyano-4-(5-methoxy-2-pyrazol-1-ylphenyl)-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-5-cyano-4-(5-methoxy-2-pyrazol-1-ylphenyl)-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169390521 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | ethyl 6-amino-5-cyano-4-(5-methoxy-2-pyrazol-1-ylphenyl)-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1cc(OC)ccc1-n1cccn1 |
| InChI | InChI=1S/C20H20N4O4/c1-4-27-20(25)17-12(2)28-19(22)15(11-21)18(17)14-10-13(26-3)6-7-16(14)24-9-5-8-23-24/h5-10,18H,4,22H2,1-3H3 |
| InChIKey | SBRBIMYMOJCPOL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |