C23H20N2O5 — CID 169390980
ethyl 6-amino-5-cyano-4-[4-(4-formyl-3-hydroxyphenyl)phenyl]-2-methyl-4H-pyran-3-carboxylate (PubChem CID 169390980) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is ethyl 6-amino-5-cyano-4-[4-(4-formyl-3-hydroxyphenyl)phenyl]-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-5-cyano-4-[4-(4-formyl-3-hydroxyphenyl)phenyl]-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169390980 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | ethyl 6-amino-5-cyano-4-[4-(4-formyl-3-hydroxyphenyl)phenyl]-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1ccc(-c2ccc(C=O)c(O)c2)cc1 |
| InChI | InChI=1S/C23H20N2O5/c1-3-29-23(28)20-13(2)30-22(25)18(11-24)21(20)15-6-4-14(5-7-15)16-8-9-17(12-26)19(27)10-16/h4-10,12,21,27H,3,25H2,1-2H3 |
| InChIKey | IWTDEQVCSYRZGZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|