C21H19N5O2 — CID 169396909
propan-2-yl 4-[2-(2,6-diamino-5-cyanopyrimidin-4-yl)phenyl]benzoate (PubChem CID 169396909) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is propan-2-yl 4-[2-(2,6-diamino-5-cyanopyrimidin-4-yl)phenyl]benzoate.
| Compound Name | propan-2-yl 4-[2-(2,6-diamino-5-cyanopyrimidin-4-yl)phenyl]benzoate |
|---|---|
| PubChem CID | 169396909 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | propan-2-yl 4-[2-(2,6-diamino-5-cyanopyrimidin-4-yl)phenyl]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(-c2ccccc2-c2nc(N)nc(N)c2C#N)cc1 |
| InChI | InChI=1S/C21H19N5O2/c1-12(2)28-20(27)14-9-7-13(8-10-14)15-5-3-4-6-16(15)18-17(11-22)19(23)26-21(24)25-18/h3-10,12H,1-2H3,(H4,23,24,25,26) |
| InChIKey | IDDKHVVOSHEJRQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |