About ethyl 5-(3,5-diethoxy-4-pyrrol-1-ylphenyl)-2H-triazole-4-carboxylate
ethyl 5-(3,5-diethoxy-4-pyrrol-1-ylphenyl)-2H-triazole-4-carboxylate (PubChem CID 169401902) has the molecular formula C19H22N4O4
and a molecular weight of 370.41 g/mol. Its IUPAC name is ethyl 5-(3,5-diethoxy-4-pyrrol-1-ylphenyl)-2H-triazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(3,5-diethoxy-4-pyrrol-1-ylphenyl)-2H-triazole-4-carboxylate |
| PubChem CID | 169401902 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | ethyl 5-(3,5-diethoxy-4-pyrrol-1-ylphenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cc(OCC)c(-n2cccc2)c(OCC)c1 |
| InChI | InChI=1S/C19H22N4O4/c1-4-25-14-11-13(16-17(21-22-20-16)19(24)27-6-3)12-15(26-5-2)18(14)23-9-7-8-10-23/h7-12H,4-6H2,1-3H3,(H,20,21,22) |
| InChIKey | RBAMAUCDPILDEO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 5-(3,5-diethoxy-4-pyrrol-1-ylphenyl)-2H-triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(3,5-diethoxy-4-pyrrol-1-ylphenyl)-2H-triazole-4-carboxylate?
The IUPAC name of ethyl 5-(3,5-diethoxy-4-pyrrol-1-ylphenyl)-2H-triazole-4-carboxylate (CID 169401902) is ethyl 5-(3,5-diethoxy-4-pyrrol-1-ylphenyl)-2H-triazole-4-carboxylate.
What is the SMILES notation for ethyl 5-(3,5-diethoxy-4-pyrrol-1-ylphenyl)-2H-triazole-4-carboxylate?
The canonical SMILES for ethyl 5-(3,5-diethoxy-4-pyrrol-1-ylphenyl)-2H-triazole-4-carboxylate is CCOC(=O)c1n[nH]nc1-c1cc(OCC)c(-n2cccc2)c(OCC)c1.
What is the InChIKey of ethyl 5-(3,5-diethoxy-4-pyrrol-1-ylphenyl)-2H-triazole-4-carboxylate?
The InChIKey is RBAMAUCDPILDEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O4/c1-4-25-14-11-13(16-17(21-22-20-16)19(24)27-6-3)12-15(26-5-2)18(14)23-9-7-8-10-23/h7-12H,4-6H2,1-3H3,(H,20,21,22).
What are the key properties of ethyl 5-(3,5-diethoxy-4-pyrrol-1-ylphenyl)-2H-triazole-4-carboxylate?
ethyl 5-(3,5-diethoxy-4-pyrrol-1-ylphenyl)-2H-triazole-4-carboxylate has a molecular weight of 370.41 g/mol, XLogP of 3.24, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(3,5-diethoxy-4-pyrrol-1-ylphenyl)-2H-triazole-4-carboxylate is sourced from PubChem (CID 169401902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).