C16H11N5O — CID 169402878
5-[2-(3-cyanophenyl)phenyl]-2H-triazole-4-carboxamide (PubChem CID 169402878) has the molecular formula C16H11N5O and a molecular weight of 289.30 g/mol. Its IUPAC name is 5-[2-(3-cyanophenyl)phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[2-(3-cyanophenyl)phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169402878 |
| Molecular Formula | C16H11N5O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 5-[2-(3-cyanophenyl)phenyl]-2H-triazole-4-carboxamide |
| SMILES | N#Cc1cccc(-c2ccccc2-c2n[nH]nc2C(N)=O)c1 |
| InChI | InChI=1S/C16H11N5O/c17-9-10-4-3-5-11(8-10)12-6-1-2-7-13(12)14-15(16(18)22)20-21-19-14/h1-8H,(H2,18,22)(H,19,20,21) |
| InChIKey | PYELAURLQKRXTJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |