About 2-amino-4-(4-hydroxy-3-methoxycarbonylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid
2-amino-4-(4-hydroxy-3-methoxycarbonylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169405156) has the molecular formula C15H12N2O8
and a molecular weight of 348.27 g/mol. Its IUPAC name is 2-amino-4-(4-hydroxy-3-methoxycarbonylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 2-amino-4-(4-hydroxy-3-methoxycarbonylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| PubChem CID | 169405156 |
| Molecular Formula | C15H12N2O8 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 2-amino-4-(4-hydroxy-3-methoxycarbonylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | COC(=O)c1cc(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)ccc1O |
| InChI | InChI=1S/C15H12N2O8/c1-25-15(24)6-4-5(2-3-7(6)18)8-9(13(20)21)11(16)17-12(19)10(8)14(22)23/h2-4,18H,1H3,(H,20,21)(H,22,23)(H3,16,17,19) |
| InChIKey | UZEAVOPBKIQOAT-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 180.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-amino-4-(4-hydroxy-3-methoxycarbonylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(4-hydroxy-3-methoxycarbonylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
The IUPAC name of 2-amino-4-(4-hydroxy-3-methoxycarbonylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (CID 169405156) is 2-amino-4-(4-hydroxy-3-methoxycarbonylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
What is the SMILES notation for 2-amino-4-(4-hydroxy-3-methoxycarbonylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
The canonical SMILES for 2-amino-4-(4-hydroxy-3-methoxycarbonylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid is COC(=O)c1cc(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)ccc1O.
What is the InChIKey of 2-amino-4-(4-hydroxy-3-methoxycarbonylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
The InChIKey is UZEAVOPBKIQOAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O8/c1-25-15(24)6-4-5(2-3-7(6)18)8-9(13(20)21)11(16)17-12(19)10(8)14(22)23/h2-4,18H,1H3,(H,20,21)(H,22,23)(H3,16,17,19).
What are the key properties of 2-amino-4-(4-hydroxy-3-methoxycarbonylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
2-amino-4-(4-hydroxy-3-methoxycarbonylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid has a molecular weight of 348.27 g/mol, XLogP of 0.51, 4 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(4-hydroxy-3-methoxycarbonylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid is sourced from PubChem (CID 169405156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).