C21H18N2O5 — CID 169406962
2-amino-4-[4-(4-ethylphenyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169406962) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is 2-amino-4-[4-(4-ethylphenyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-[4-(4-ethylphenyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169406962 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-amino-4-[4-(4-ethylphenyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | CCc1ccc(-c2ccc(-c3c(C(=O)O)c(N)[nH]c(=O)c3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C21H18N2O5/c1-2-11-3-5-12(6-4-11)13-7-9-14(10-8-13)15-16(20(25)26)18(22)23-19(24)17(15)21(27)28/h3-10H,2H2,1H3,(H,25,26)(H,27,28)(H3,22,23,24) |
| InChIKey | OERSDTASCINWAA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 133.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |