About 2-amino-4-(2-ethoxycarbonyl-1-benzofuran-5-yl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid
2-amino-4-(2-ethoxycarbonyl-1-benzofuran-5-yl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169407531) has the molecular formula C18H14N2O8
and a molecular weight of 386.32 g/mol. Its IUPAC name is 2-amino-4-(2-ethoxycarbonyl-1-benzofuran-5-yl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 2-amino-4-(2-ethoxycarbonyl-1-benzofuran-5-yl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| PubChem CID | 169407531 |
| Molecular Formula | C18H14N2O8 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-amino-4-(2-ethoxycarbonyl-1-benzofuran-5-yl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | CCOC(=O)c1cc2cc(-c3c(C(=O)O)c(N)[nH]c(=O)c3C(=O)O)ccc2o1 |
| InChI | InChI=1S/C18H14N2O8/c1-2-27-18(26)10-6-8-5-7(3-4-9(8)28-10)11-12(16(22)23)14(19)20-15(21)13(11)17(24)25/h3-6H,2H2,1H3,(H,22,23)(H,24,25)(H3,19,20,21) |
| InChIKey | JHQVTMWZDPKRMB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 172.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-amino-4-(2-ethoxycarbonyl-1-benzofuran-5-yl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(2-ethoxycarbonyl-1-benzofuran-5-yl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
The IUPAC name of 2-amino-4-(2-ethoxycarbonyl-1-benzofuran-5-yl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (CID 169407531) is 2-amino-4-(2-ethoxycarbonyl-1-benzofuran-5-yl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
What is the SMILES notation for 2-amino-4-(2-ethoxycarbonyl-1-benzofuran-5-yl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
The canonical SMILES for 2-amino-4-(2-ethoxycarbonyl-1-benzofuran-5-yl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid is CCOC(=O)c1cc2cc(-c3c(C(=O)O)c(N)[nH]c(=O)c3C(=O)O)ccc2o1.
What is the InChIKey of 2-amino-4-(2-ethoxycarbonyl-1-benzofuran-5-yl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
The InChIKey is JHQVTMWZDPKRMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O8/c1-2-27-18(26)10-6-8-5-7(3-4-9(8)28-10)11-12(16(22)23)14(19)20-15(21)13(11)17(24)25/h3-6H,2H2,1H3,(H,22,23)(H,24,25)(H3,19,20,21).
What are the key properties of 2-amino-4-(2-ethoxycarbonyl-1-benzofuran-5-yl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
2-amino-4-(2-ethoxycarbonyl-1-benzofuran-5-yl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid has a molecular weight of 386.32 g/mol, XLogP of 1.94, 5 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(2-ethoxycarbonyl-1-benzofuran-5-yl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid is sourced from PubChem (CID 169407531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).