C22H39N7O10P2-2 — CID 169408502
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate;bis(cyclohexanamine) (PubChem CID 169408502) has the molecular formula C22H39N7O10P2-2 and a molecular weight of 623.54 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate;bis(cyclohexanamine).
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate;bis(cyclohexanamine) |
|---|---|
| PubChem CID | 169408502 |
| Molecular Formula | C22H39N7O10P2-2 |
| Molecular Weight | 623.54 g/mol |
| Exact Mass | 623.22 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate;bis(cyclohexanamine) |
| SMILES | NC1CCCCC1.NC1CCCCC1.Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H15N5O10P2.2C6H13N/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(24-10)1-23-27(21,22)25-26(18,19)20;2*7-6-4-2-1-3-5-6/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H2,11,12,13)(H2,18,19,20);2*6H,1-5,7H2/p-2/t4-,6-,7-,10-;;/m1../s1 |
| InChIKey | SCOUEIPNDLFPCX-IDIVVRGQSA-L |
| XLogP | -0.45 |
| TPSA | 290.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.54 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|