C14H18O4 — CID 169408925
ethyl (E)-3-[(3aS,7aR)-3a-methyl-2-oxo-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate (PubChem CID 169408925) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is ethyl (E)-3-[(3aS,7aR)-3a-methyl-2-oxo-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3aS,7aR)-3a-methyl-2-oxo-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate |
|---|---|
| PubChem CID | 169408925 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | ethyl (E)-3-[(3aS,7aR)-3a-methyl-2-oxo-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@]12C=CCC[C@@]1(C)CC(=O)O2 |
| InChI | InChI=1S/C14H18O4/c1-3-17-11(15)6-9-14-8-5-4-7-13(14,2)10-12(16)18-14/h5-6,8-9H,3-4,7,10H2,1-2H3/b9-6+/t13-,14+/m0/s1 |
| InChIKey | SBVIGUNJHUHMFL-YESVKVCSSA-N |
| XLogP | 2.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|