C21H20F12O4 — CID 169408935
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl (E)-3-[(3aS,7aR)-2-oxo-3a-propyl-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate (PubChem CID 169408935) has the molecular formula C21H20F12O4 and a molecular weight of 564.36 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl (E)-3-[(3aS,7aR)-2-oxo-3a-propyl-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl (E)-3-[(3aS,7aR)-2-oxo-3a-propyl-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate |
|---|---|
| PubChem CID | 169408935 |
| Molecular Formula | C21H20F12O4 |
| Molecular Weight | 564.36 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl (E)-3-[(3aS,7aR)-2-oxo-3a-propyl-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate |
| SMILES | CCC[C@@]12CCC=C[C@]1(/C=C/C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)OC(=O)C2 |
| InChI | InChI=1S/C21H20F12O4/c1-2-6-15-7-3-4-8-16(15,37-13(35)10-15)9-5-12(34)36-11-17(24,25)19(28,29)21(32,33)20(30,31)18(26,27)14(22)23/h4-5,8-9,14H,2-3,6-7,10-11H2,1H3/b9-5+/t15-,16+/m0/s1 |
| InChIKey | HUOPKSRVOOJDQZ-NJEVBOHQSA-N |
| XLogP | 6.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.36 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|